Multi-phase composite with multi-dimensional nano-structure is proved to have a more optimized electronic structure and abundant reactive active sites, which can effectively enhance the electrochemical behavior of the material. Herein, a three-phase hierarchical nanostructure electrode, Ni(OH)2/(Ni(OH)2(NiOOH).167).857@Ni3S2 (Ni(O)OH@Ni3S2), composed of 3-dimension (3D) Ni3S2 particles coated on the surface of the interlaced 1-dimension (1D) nanowires and 2-dimension (2D) nanosheets Ni(O)OH array, is successfully designed and constructed by a f...